C28H39BrO8P2 — CID 159106172
3-(bromomethyl)-1-benzofuran;3-(diethoxyphosphorylmethyl)-1-benzofuran;triethyl phosphite (PubChem CID 159106172) has the molecular formula C28H39BrO8P2 and a molecular weight of 645.46 g/mol. Its IUPAC name is 3-(bromomethyl)-1-benzofuran;3-(diethoxyphosphorylmethyl)-1-benzofuran;triethyl phosphite.
| Compound Name | 3-(bromomethyl)-1-benzofuran;3-(diethoxyphosphorylmethyl)-1-benzofuran;triethyl phosphite |
|---|---|
| PubChem CID | 159106172 |
| Molecular Formula | C28H39BrO8P2 |
| Molecular Weight | 645.46 g/mol |
| Exact Mass | 644.13 |
| IUPAC Name | 3-(bromomethyl)-1-benzofuran;3-(diethoxyphosphorylmethyl)-1-benzofuran;triethyl phosphite |
| SMILES | BrCc1coc2ccccc12.CCOP(=O)(Cc1coc2ccccc12)OCC.CCOP(OCC)OCC |
| InChI | InChI=1S/C13H17O4P.C9H7BrO.C6H15O3P/c1-3-16-18(14,17-4-2)10-11-9-15-13-8-6-5-7-12(11)13;10-5-7-6-11-9-4-2-1-3-8(7)9;1-4-7-10(8-5-2)9-6-3/h5-9H,3-4,10H2,1-2H3;1-4,6H,5H2;4-6H2,1-3H3 |
| InChIKey | KDXMCCWUCKSTDF-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.46 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|