C27H40O6P2 — CID 58596354
[7-(diethoxyphosphorylmethyl)-9-methyl-9-propylfluoren-2-yl]methyl diethyl phosphite (PubChem CID 58596354) has the molecular formula C27H40O6P2 and a molecular weight of 522.56 g/mol. Its IUPAC name is [7-(diethoxyphosphorylmethyl)-9-methyl-9-propylfluoren-2-yl]methyl diethyl phosphite.
| Compound Name | [7-(diethoxyphosphorylmethyl)-9-methyl-9-propylfluoren-2-yl]methyl diethyl phosphite |
|---|---|
| PubChem CID | 58596354 |
| Molecular Formula | C27H40O6P2 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [7-(diethoxyphosphorylmethyl)-9-methyl-9-propylfluoren-2-yl]methyl diethyl phosphite |
| SMILES | CCCC1(C)c2cc(COP(OCC)OCC)ccc2-c2ccc(CP(=O)(OCC)OCC)cc21 |
| InChI | InChI=1S/C27H40O6P2/c1-7-16-27(6)25-17-21(19-31-34(29-8-2)30-9-3)12-14-23(25)24-15-13-22(18-26(24)27)20-35(28,32-10-4)33-11-5/h12-15,17-18H,7-11,16,19-20H2,1-6H3 |
| InChIKey | ZXEZYOLFBIZKRM-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|