C31H54O5Si — CID 10324846
ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate (PubChem CID 10324846) has the molecular formula C31H54O5Si and a molecular weight of 534.85 g/mol. Its IUPAC name is ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate.
| Compound Name | ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
|---|---|
| PubChem CID | 10324846 |
| Molecular Formula | C31H54O5Si |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | ethyl (2S,4E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
| SMILES | C=C[C@@H]1C[C@H]([C@](C)(C/C=C(C)/C=C/CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)C(=O)OCC)OC(C)(C)O1 |
| InChI | InChI=1S/C31H54O5Si/c1-13-26-22-27(36-30(8,9)35-26)31(10,28(32)33-14-2)21-20-24(3)18-16-15-17-19-25(4)23-34-37(11,12)29(5,6)7/h13,16,18-20,26-27H,1,14-15,17,21-23H2,2-12H3/b18-16+,24-20+,25-19+/t26-,27-,31+/m1/s1 |
| InChIKey | SFGSIXYNIGGERE-DLTCDSBCSA-N |
| XLogP | 8.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|