C26H48O7Si2 — CID 11375976
2,2-dimethyl-5-[(1R,3S)-3-(5-oxo-2H-furan-3-yl)-1,3-bis(triethylsilyloxy)propyl]-1,3-dioxane-5-carbaldehyde (PubChem CID 11375976) has the molecular formula C26H48O7Si2 and a molecular weight of 528.84 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(1R,3S)-3-(5-oxo-2H-furan-3-yl)-1,3-bis(triethylsilyloxy)propyl]-1,3-dioxane-5-carbaldehyde.
| Compound Name | 2,2-dimethyl-5-[(1R,3S)-3-(5-oxo-2H-furan-3-yl)-1,3-bis(triethylsilyloxy)propyl]-1,3-dioxane-5-carbaldehyde |
|---|---|
| PubChem CID | 11375976 |
| Molecular Formula | C26H48O7Si2 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | 2,2-dimethyl-5-[(1R,3S)-3-(5-oxo-2H-furan-3-yl)-1,3-bis(triethylsilyloxy)propyl]-1,3-dioxane-5-carbaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@@H](C[C@@H](O[Si](CC)(CC)CC)C1(C=O)COC(C)(C)OC1)C1=CC(=O)OC1 |
| InChI | InChI=1S/C26H48O7Si2/c1-9-34(10-2,11-3)32-22(21-15-24(28)29-17-21)16-23(33-35(12-4,13-5)14-6)26(18-27)19-30-25(7,8)31-20-26/h15,18,22-23H,9-14,16-17,19-20H2,1-8H3/t22-,23+/m0/s1 |
| InChIKey | DFNLWRACDIQFMX-XZOQPEGZSA-N |
| XLogP | 5.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|