C21H32O5Si — CID 162417843
methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate (PubChem CID 162417843) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate.
| Compound Name | methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate |
|---|---|
| PubChem CID | 162417843 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | methyl (2S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate |
| SMILES | COC(=O)C12C=CC(OC1=O)[C@H]1CC(C)(C)C(O[Si](C)(C)C(C)(C)C)=C[C@H]12 |
| InChI | InChI=1S/C21H32O5Si/c1-19(2,3)27(7,8)26-16-11-14-13(12-20(16,4)5)15-9-10-21(14,17(22)24-6)18(23)25-15/h9-11,13-15H,12H2,1-8H3/t13-,14+,15?,21?/m0/s1 |
| InChIKey | FLLWIFRHLGHEGQ-BYCAXTHASA-N |
| XLogP | 4.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|