C21H29NO3Si — CID 102381973
methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-8-azabicyclo[3.2.1]octa-2,6-diene-2-carboxylate (PubChem CID 102381973) has the molecular formula C21H29NO3Si and a molecular weight of 371.55 g/mol. Its IUPAC name is methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-8-azabicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
| Compound Name | methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-8-azabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
|---|---|
| PubChem CID | 102381973 |
| Molecular Formula | C21H29NO3Si |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-8-azabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)C[C@@H]2C=C[C@H]1N2c1ccccc1 |
| InChI | InChI=1S/C21H29NO3Si/c1-21(2,3)26(5,6)25-18-14-16-12-13-17(19(18)20(23)24-4)22(16)15-10-8-7-9-11-15/h7-13,16-17H,14H2,1-6H3/t16-,17+/m0/s1 |
| InChIKey | SGEASAKGDXGUKA-DLBZAZTESA-N |
| XLogP | 4.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|