C32H40N2O5Si — CID 102223693
methyl 5-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-2-phenyl-2,4-dihydropyrimidine-6-carboxylate (PubChem CID 102223693) has the molecular formula C32H40N2O5Si and a molecular weight of 560.77 g/mol. Its IUPAC name is methyl 5-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-2-phenyl-2,4-dihydropyrimidine-6-carboxylate.
| Compound Name | methyl 5-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-2-phenyl-2,4-dihydropyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 102223693 |
| Molecular Formula | C32H40N2O5Si |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | methyl 5-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-2-phenyl-2,4-dihydropyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)CN(c2ccc(OC)cc2)C(c2ccccc2)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H40N2O5Si/c1-32(2,3)40(7,8)39-28-22-33(24-14-18-26(36-4)19-15-24)30(23-12-10-9-11-13-23)34(29(28)31(35)38-6)25-16-20-27(37-5)21-17-25/h9-21,30H,22H2,1-8H3 |
| InChIKey | IZHWMWVLTFQMHJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|