C29H40N2O4Si — CID 132508017
[5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-2-phenyl-3,6-dihydrooxazin-4-yl]-piperidin-1-ylmethanone (PubChem CID 132508017) has the molecular formula C29H40N2O4Si and a molecular weight of 508.74 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-2-phenyl-3,6-dihydrooxazin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-2-phenyl-3,6-dihydrooxazin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 132508017 |
| Molecular Formula | C29H40N2O4Si |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-2-phenyl-3,6-dihydrooxazin-4-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(C2C(C(=O)N3CCCCC3)=C(O[Si](C)(C)C(C)(C)C)CON2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H40N2O4Si/c1-29(2,3)36(5,6)35-25-21-34-31(23-13-9-7-10-14-23)27(22-15-17-24(33-4)18-16-22)26(25)28(32)30-19-11-8-12-20-30/h7,9-10,13-18,27H,8,11-12,19-21H2,1-6H3 |
| InChIKey | OWNNALWIPAWQOO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|