C27H32N4O2 — CID 55919334
[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone (PubChem CID 55919334) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone.
| Compound Name | [4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 55919334 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | [4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone |
| SMILES | COc1ccc(N2CCCN(C(=O)c3nn(-c4ccccc4)c4c3CCCCC4)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-33-23-15-13-21(14-16-23)29-17-8-18-30(20-19-29)27(32)26-24-11-6-3-7-12-25(24)31(28-26)22-9-4-2-5-10-22/h2,4-5,9-10,13-16H,3,6-8,11-12,17-20H2,1H3 |
| InChIKey | ZTQPWEPQFOFXPU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|