C27H27N5O2 — CID 55918131
(1,5-diphenyl-1,2,4-triazol-3-yl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 55918131) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is (1,5-diphenyl-1,2,4-triazol-3-yl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (1,5-diphenyl-1,2,4-triazol-3-yl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 55918131 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (1,5-diphenyl-1,2,4-triazol-3-yl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | COc1ccc(N2CCCN(C(=O)c3nc(-c4ccccc4)n(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-34-24-15-13-22(14-16-24)30-17-8-18-31(20-19-30)27(33)25-28-26(21-9-4-2-5-10-21)32(29-25)23-11-6-3-7-12-23/h2-7,9-16H,8,17-20H2,1H3 |
| InChIKey | SPTAZKZQYZDWML-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|