C21H21ClN4O — CID 50745653
azepan-1-yl-[1-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]methanone (PubChem CID 50745653) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is azepan-1-yl-[1-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]methanone.
| Compound Name | azepan-1-yl-[1-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 50745653 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | azepan-1-yl-[1-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]methanone |
| SMILES | O=C(c1nc(-c2ccccc2)n(-c2ccc(Cl)cc2)n1)N1CCCCCC1 |
| InChI | InChI=1S/C21H21ClN4O/c22-17-10-12-18(13-11-17)26-20(16-8-4-3-5-9-16)23-19(24-26)21(27)25-14-6-1-2-7-15-25/h3-5,8-13H,1-2,6-7,14-15H2 |
| InChIKey | MKJUJIAQOKBSAU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |