C30H44N2O5Si — CID 132542460
tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-4,7-dihydro-2H-1,3-diazepine-5-carboxylate (PubChem CID 132542460) has the molecular formula C30H44N2O5Si and a molecular weight of 540.78 g/mol. Its IUPAC name is tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-4,7-dihydro-2H-1,3-diazepine-5-carboxylate.
| Compound Name | tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-4,7-dihydro-2H-1,3-diazepine-5-carboxylate |
|---|---|
| PubChem CID | 132542460 |
| Molecular Formula | C30H44N2O5Si |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-1,3-bis(4-methoxyphenyl)-4,7-dihydro-2H-1,3-diazepine-5-carboxylate |
| SMILES | COc1ccc(N2CC(O[Si](C)(C)C(C)(C)C)=C(C(=O)OC(C)(C)C)CN(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C30H44N2O5Si/c1-29(2,3)36-28(33)26-19-31(22-11-15-24(34-7)16-12-22)21-32(23-13-17-25(35-8)18-14-23)20-27(26)37-38(9,10)30(4,5)6/h11-18H,19-21H2,1-10H3 |
| InChIKey | JRCNHCLEYQPPKI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|