C23H35NO7Si — CID 11476828
[(3R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-ethoxy-3-oxopropyl)-4-hydroxy-2-oxopiperidin-3-yl] benzoate (PubChem CID 11476828) has the molecular formula C23H35NO7Si and a molecular weight of 465.62 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-ethoxy-3-oxopropyl)-4-hydroxy-2-oxopiperidin-3-yl] benzoate.
| Compound Name | [(3R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-ethoxy-3-oxopropyl)-4-hydroxy-2-oxopiperidin-3-yl] benzoate |
|---|---|
| PubChem CID | 11476828 |
| Molecular Formula | C23H35NO7Si |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | [(3R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(3-ethoxy-3-oxopropyl)-4-hydroxy-2-oxopiperidin-3-yl] benzoate |
| SMILES | CCOC(=O)CC[C@@H]1NC(=O)[C@H](OC(=O)c2ccccc2)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H35NO7Si/c1-7-29-17(25)14-13-16-19(31-32(5,6)23(2,3)4)18(26)20(21(27)24-16)30-22(28)15-11-9-8-10-12-15/h8-12,16,18-20,26H,7,13-14H2,1-6H3,(H,24,27)/t16-,18-,19-,20+/m0/s1 |
| InChIKey | ARCGKQLJXUVQMS-FRYIKTPZSA-N |
| XLogP | 2.81 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|