C28H30N2O6S2 — CID 163026505
methyl 4-[(1R,2R,3R,6R,7S,8S)-1,3-dibenzamido-2-hydroxy-11-oxo-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate (PubChem CID 163026505) has the molecular formula C28H30N2O6S2 and a molecular weight of 554.69 g/mol. Its IUPAC name is methyl 4-[(1R,2R,3R,6R,7S,8S)-1,3-dibenzamido-2-hydroxy-11-oxo-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate.
| Compound Name | methyl 4-[(1R,2R,3R,6R,7S,8S)-1,3-dibenzamido-2-hydroxy-11-oxo-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate |
|---|---|
| PubChem CID | 163026505 |
| Molecular Formula | C28H30N2O6S2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | methyl 4-[(1R,2R,3R,6R,7S,8S)-1,3-dibenzamido-2-hydroxy-11-oxo-5,9-dithiatricyclo[6.2.1.02,6]undecan-7-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@@H]2SC[C@](NC(=O)c3ccccc3)(C2=O)[C@]2(O)[C@@H](NC(=O)c3ccccc3)CS[C@H]12 |
| InChI | InChI=1S/C28H30N2O6S2/c1-36-21(31)14-8-13-19-22-23(32)27(16-38-22,30-26(34)18-11-6-3-7-12-18)28(35)20(15-37-24(19)28)29-25(33)17-9-4-2-5-10-17/h2-7,9-12,19-20,22,24,35H,8,13-16H2,1H3,(H,29,33)(H,30,34)/t19-,20+,22+,24-,27+,28+/m1/s1 |
| InChIKey | KRLFWXIDUTYSLM-IAEXRJBKSA-N |
| XLogP | 2.46 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |