C15H28N2O2 — CID 82247246
prop-2-enyl 2-(2-methylpropyl)-5-propan-2-ylpiperazine-1-carboxylate (PubChem CID 82247246) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is prop-2-enyl 2-(2-methylpropyl)-5-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | prop-2-enyl 2-(2-methylpropyl)-5-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 82247246 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | prop-2-enyl 2-(2-methylpropyl)-5-propan-2-ylpiperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(C(C)C)NCC1CC(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-6-7-19-15(18)17-10-14(12(4)5)16-9-13(17)8-11(2)3/h6,11-14,16H,1,7-10H2,2-5H3 |
| InChIKey | RXBTXSIVGSZVAZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|