C32H32N2O3S — CID 67750260
prop-2-enyl (2S,4S)-2-[(Z)-(2-oxopyrrolidin-3-ylidene)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 67750260) has the molecular formula C32H32N2O3S and a molecular weight of 524.69 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[(Z)-(2-oxopyrrolidin-3-ylidene)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[(Z)-(2-oxopyrrolidin-3-ylidene)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67750260 |
| Molecular Formula | C32H32N2O3S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[(Z)-(2-oxopyrrolidin-3-ylidene)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1/C=C1/CCNC1=O |
| InChI | InChI=1S/C32H32N2O3S/c1-2-20-37-31(36)34-23-29(22-28(34)21-24-18-19-33-30(24)35)38-32(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h2-17,21,28-29H,1,18-20,22-23H2,(H,33,35)/b24-21-/t28-,29+/m1/s1 |
| InChIKey | OMLMILSEKHUKPH-YDWLBUCASA-N |
| XLogP | 5.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|