C34H38N4O4S — CID 11585201
prop-2-enyl (2S,4S)-2-[[amino-(4-hydroxypiperidin-1-yl)methylidene]carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 11585201) has the molecular formula C34H38N4O4S and a molecular weight of 598.77 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[[amino-(4-hydroxypiperidin-1-yl)methylidene]carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[[amino-(4-hydroxypiperidin-1-yl)methylidene]carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11585201 |
| Molecular Formula | C34H38N4O4S |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[[amino-(4-hydroxypiperidin-1-yl)methylidene]carbamoyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1C(=O)/N=C(\N)N1CCC(O)CC1 |
| InChI | InChI=1S/C34H38N4O4S/c1-2-22-42-33(41)38-24-29(23-30(38)31(40)36-32(35)37-20-18-28(39)19-21-37)43-34(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h2-17,28-30,39H,1,18-24H2,(H2,35,36,40)/t29-,30-/m0/s1 |
| InChIKey | RGLRGMUSUJJJNG-KYJUHHDHSA-N |
| XLogP | 4.78 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|