C32H29N3O5S — CID 57277448
(4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 57277448) has the molecular formula C32H29N3O5S and a molecular weight of 567.67 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57277448 |
| Molecular Formula | C32H29N3O5S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-carbamoyl-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | NC(=O)[C@@H]1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H29N3O5S/c33-30(36)29-20-28(21-34(29)31(37)40-22-23-16-18-27(19-17-23)35(38)39)41-32(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-19,28-29H,20-22H2,(H2,33,36)/t28-,29-/m0/s1 |
| InChIKey | HNLNCCULDYIWQG-VMPREFPWSA-N |
| XLogP | 5.88 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|