C37H40N4O8S2 — CID 70192735
(4-nitrophenyl)methyl (2S,4S)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxo-1-(sulfamoylamino)ethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 70192735) has the molecular formula C37H40N4O8S2 and a molecular weight of 732.88 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxo-1-(sulfamoylamino)ethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxo-1-(sulfamoylamino)ethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70192735 |
| Molecular Formula | C37H40N4O8S2 |
| Molecular Weight | 732.88 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxo-1-(sulfamoylamino)ethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C(NS(N)(=O)=O)[C@@H]1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C37H40N4O8S2/c1-36(2,3)49-34(42)33(39-51(38,46)47)32-23-31(24-40(32)35(43)48-25-26-19-21-30(22-20-26)41(44)45)50-37(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,31-33,39H,23-25H2,1-3H3,(H2,38,46,47)/t31-,32-,33?/m0/s1 |
| InChIKey | YWZKNNRXKUCYLI-KOPQTXDBSA-N |
| XLogP | 5.90 |
| TPSA | 171.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.88 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|