C35H38N2O6S2 — CID 10675711
(4-methoxyphenyl)methyl (2S,4S)-2-[(2-hydroxyethylsulfonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 10675711) has the molecular formula C35H38N2O6S2 and a molecular weight of 646.83 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-[(2-hydroxyethylsulfonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(2-hydroxyethylsulfonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10675711 |
| Molecular Formula | C35H38N2O6S2 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(2-hydroxyethylsulfonylamino)methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2C[C@@H](SC(c3ccccc3)(c3ccccc3)c3ccccc3)C[C@H]2CNS(=O)(=O)CCO)cc1 |
| InChI | InChI=1S/C35H38N2O6S2/c1-42-32-19-17-27(18-20-32)26-43-34(39)37-25-33(23-31(37)24-36-45(40,41)22-21-38)44-35(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-20,31,33,36,38H,21-26H2,1H3/t31-,33-/m0/s1 |
| InChIKey | WYBZRDZBZOFNPA-WEZIJMHWSA-N |
| XLogP | 5.41 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|