C38H35NO3S — CID 69432363
phenyl (2S,4R)-2-(phenylmethoxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 69432363) has the molecular formula C38H35NO3S and a molecular weight of 585.77 g/mol. Its IUPAC name is phenyl (2S,4R)-2-(phenylmethoxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | phenyl (2S,4R)-2-(phenylmethoxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69432363 |
| Molecular Formula | C38H35NO3S |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | phenyl (2S,4R)-2-(phenylmethoxymethyl)-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C38H35NO3S/c40-37(42-35-24-14-5-15-25-35)39-27-36(26-34(39)29-41-28-30-16-6-1-7-17-30)43-38(31-18-8-2-9-19-31,32-20-10-3-11-21-32)33-22-12-4-13-23-33/h1-25,34,36H,26-29H2/t34-,36+/m0/s1 |
| InChIKey | LKRGCUMPHZFODT-PUDHBBIYSA-N |
| XLogP | 8.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|