C42H51N3O3S — CID 67754104
tert-butyl 2-[[[(2S,3S)-2-(benzylamino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 67754104) has the molecular formula C42H51N3O3S and a molecular weight of 677.96 g/mol. Its IUPAC name is tert-butyl 2-[[[(2S,3S)-2-(benzylamino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[(2S,3S)-2-(benzylamino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67754104 |
| Molecular Formula | C42H51N3O3S |
| Molecular Weight | 677.96 g/mol |
| Exact Mass | 677.37 |
| IUPAC Name | tert-butyl 2-[[[(2S,3S)-2-(benzylamino)-3-methylpentanoyl]amino]methyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | CC[C@H](C)[C@H](NCc1ccccc1)C(=O)NCC1CC(SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H51N3O3S/c1-6-31(2)38(43-28-32-19-11-7-12-20-32)39(46)44-29-36-27-37(30-45(36)40(47)48-41(3,4)5)49-42(33-21-13-8-14-22-33,34-23-15-9-16-24-34)35-25-17-10-18-26-35/h7-26,31,36-38,43H,6,27-30H2,1-5H3,(H,44,46)/t31-,36?,37?,38-/m0/s1 |
| InChIKey | CIFIQFKKELVRIJ-CHQXOCGBSA-N |
| XLogP | 8.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.96 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|