C18H33NO5SSi — CID 173348591
prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-methylsulfonylprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 173348591) has the molecular formula C18H33NO5SSi and a molecular weight of 403.62 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-methylsulfonylprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-methylsulfonylprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173348591 |
| Molecular Formula | C18H33NO5SSi |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[(E)-3-methylsulfonylprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](C(C)(C)C)C[C@@]1(/C=C/CS(C)(=O)=O)O[SiH](C)C |
| InChI | InChI=1S/C18H33NO5SSi/c1-8-11-23-16(20)19-14-15(17(2,3)4)13-18(19,24-26(6)7)10-9-12-25(5,21)22/h8-10,15,26H,1,11-14H2,2-7H3/b10-9+/t15-,18+/m0/s1 |
| InChIKey | WXUYUWPBMDNRCP-VSNRRYGASA-N |
| XLogP | 2.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|