C17H33NO3Si — CID 173324867
tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-ethenylpyrrolidine-1-carboxylate (PubChem CID 173324867) has the molecular formula C17H33NO3Si and a molecular weight of 327.54 g/mol. Its IUPAC name is tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-ethenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-ethenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173324867 |
| Molecular Formula | C17H33NO3Si |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl 4-tert-butyl-2-dimethylsilyloxy-2-ethenylpyrrolidine-1-carboxylate |
| SMILES | C=CC1(O[SiH](C)C)CC(C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H33NO3Si/c1-10-17(21-22(8)9)11-13(15(2,3)4)12-18(17)14(19)20-16(5,6)7/h10,13,22H,1,11-12H2,2-9H3 |
| InChIKey | MSSZZNNGMJHQHF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|