C44H64N2O6Si — CID 173291258
tert-butyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 173291258) has the molecular formula C44H64N2O6Si and a molecular weight of 745.09 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173291258 |
| Molecular Formula | C44H64N2O6Si |
| Molecular Weight | 745.09 g/mol |
| Exact Mass | 744.45 |
| IUPAC Name | tert-butyl (2S,4R)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CN(CC(CCOC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@]1(O[SiH](C)C)C[C@H](C(C)(C)C)CN1C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H64N2O6Si/c1-40(2,3)37-30-43(52-53(11)12,46(32-37)39(48)51-42(7,8)9)36(31-45(10)38(47)50-41(4,5)6)28-29-49-44(33-22-16-13-17-23-33,34-24-18-14-19-25-34)35-26-20-15-21-27-35/h13-27,36-37,53H,28-32H2,1-12H3/t36?,37-,43-/m0/s1 |
| InChIKey | BOFPYCAEZHSOCF-HBQQGESKSA-N |
| XLogP | 9.87 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.09 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|