C23H39NO4Si — CID 173329573
tert-butyl (2R,3S)-3-tert-butyl-2-dimethylsilyloxy-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 173329573) has the molecular formula C23H39NO4Si and a molecular weight of 421.65 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-tert-butyl-2-dimethylsilyloxy-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-tert-butyl-2-dimethylsilyloxy-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173329573 |
| Molecular Formula | C23H39NO4Si |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | tert-butyl (2R,3S)-3-tert-butyl-2-dimethylsilyloxy-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C[SiH](C)O[C@@]1(COCc2ccccc2)[C@H](C(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39NO4Si/c1-21(2,3)19-14-15-24(20(25)27-22(4,5)6)23(19,28-29(7)8)17-26-16-18-12-10-9-11-13-18/h9-13,19,29H,14-17H2,1-8H3/t19-,23-/m0/s1 |
| InChIKey | KSAJNSZMPAOSCT-CVDCTZTESA-N |
| XLogP | 5.20 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|