C43H62N2O6Si — CID 173291262
tert-butyl (2S,4S)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 173291262) has the molecular formula C43H62N2O6Si and a molecular weight of 731.06 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173291262 |
| Molecular Formula | C43H62N2O6Si |
| Molecular Weight | 731.06 g/mol |
| Exact Mass | 730.44 |
| IUPAC Name | tert-butyl (2S,4S)-4-tert-butyl-2-dimethylsilyloxy-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-trityloxybutan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C[SiH](C)O[C@]1(C(CCOC(c2ccccc2)(c2ccccc2)c2ccccc2)CNC(=O)OC(C)(C)C)C[C@@H](C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C43H62N2O6Si/c1-39(2,3)36-29-42(51-52(10)11,45(31-36)38(47)50-41(7,8)9)35(30-44-37(46)49-40(4,5)6)27-28-48-43(32-21-15-12-16-22-32,33-23-17-13-18-24-33)34-25-19-14-20-26-34/h12-26,35-36,52H,27-31H2,1-11H3,(H,44,46)/t35?,36-,42+/m1/s1 |
| InChIKey | XAPUHQDTNMUOEM-KWLWKXTLSA-N |
| XLogP | 9.53 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.06 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|