C30H34N2O4 — CID 151607579
tert-butyl N-[(2R)-2-cyano-3-(2-trityloxyethoxy)propyl]carbamate (PubChem CID 151607579) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-cyano-3-(2-trityloxyethoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-cyano-3-(2-trityloxyethoxy)propyl]carbamate |
|---|---|
| PubChem CID | 151607579 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tert-butyl N-[(2R)-2-cyano-3-(2-trityloxyethoxy)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C#N)COCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34N2O4/c1-29(2,3)36-28(33)32-22-24(21-31)23-34-19-20-35-30(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,24H,19-20,22-23H2,1-3H3,(H,32,33)/t24-/m0/s1 |
| InChIKey | QLUNZHNHOHEOKH-DEOSSOPVSA-N |
| XLogP | 5.68 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|