C23H30N2O5 — CID 155613187
tert-butyl N-[4-(2-nitro-1,1-diphenylethoxy)butyl]carbamate (PubChem CID 155613187) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is tert-butyl N-[4-(2-nitro-1,1-diphenylethoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-nitro-1,1-diphenylethoxy)butyl]carbamate |
|---|---|
| PubChem CID | 155613187 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | tert-butyl N-[4-(2-nitro-1,1-diphenylethoxy)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOC(C[N+](=O)[O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O5/c1-22(2,3)30-21(26)24-16-10-11-17-29-23(18-25(27)28,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15H,10-11,16-18H2,1-3H3,(H,24,26) |
| InChIKey | JWQBGCHHTGJNTO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|