C33H37N3O5 — CID 59463762
tert-butyl N-[4-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)butyl]carbamate (PubChem CID 59463762) has the molecular formula C33H37N3O5 and a molecular weight of 555.67 g/mol. Its IUPAC name is tert-butyl N-[4-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)butyl]carbamate |
|---|---|
| PubChem CID | 59463762 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | tert-butyl N-[4-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(CCn1ccc(=O)[nH]c1=O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37N3O5/c1-32(2,3)41-31(39)34-23-25(19-21-36-22-20-29(37)35-30(36)38)24-40-33(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-18,20,22,25H,19,21,23-24H2,1-3H3,(H,34,39)(H,35,37,38) |
| InChIKey | UNRDJBXHCFCKSJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|