C27H28N2O4 — CID 139885591
tert-butyl N-(2-oxo-1-trityloxyazetidin-3-yl)carbamate (PubChem CID 139885591) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl N-(2-oxo-1-trityloxyazetidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(2-oxo-1-trityloxyazetidin-3-yl)carbamate |
|---|---|
| PubChem CID | 139885591 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl N-(2-oxo-1-trityloxyazetidin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(OC(c2ccccc2)(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C27H28N2O4/c1-26(2,3)32-25(31)28-23-19-29(24(23)30)33-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23H,19H2,1-3H3,(H,28,31) |
| InChIKey | YIFKIXQAGGANQR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|