C31H37NO6S — CID 71474953
tert-butyl (3S,4R)-3-methylsulfonyloxy-4-(trityloxymethyl)piperidine-1-carboxylate (PubChem CID 71474953) has the molecular formula C31H37NO6S and a molecular weight of 551.71 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-methylsulfonyloxy-4-(trityloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-methylsulfonyloxy-4-(trityloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71474953 |
| Molecular Formula | C31H37NO6S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | tert-butyl (3S,4R)-3-methylsulfonyloxy-4-(trityloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C31H37NO6S/c1-30(2,3)37-29(33)32-21-20-24(28(22-32)38-39(4,34)35)23-36-31(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,24,28H,20-23H2,1-4H3/t24-,28-/m1/s1 |
| InChIKey | XCOBNXRWCHQOBR-UFHPHHKVSA-N |
| XLogP | 5.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|