C16H26N4O5S — CID 71475006
tert-butyl (3S,4R)-3-methylsulfonyloxy-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate (PubChem CID 71475006) has the molecular formula C16H26N4O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-methylsulfonyloxy-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-methylsulfonyloxy-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71475006 |
| Molecular Formula | C16H26N4O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | tert-butyl (3S,4R)-3-methylsulfonyloxy-4-[(pyrimidin-2-ylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](CNc2ncccn2)[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H26N4O5S/c1-16(2,3)24-15(21)20-9-6-12(13(11-20)25-26(4,22)23)10-19-14-17-7-5-8-18-14/h5,7-8,12-13H,6,9-11H2,1-4H3,(H,17,18,19)/t12-,13-/m1/s1 |
| InChIKey | SHKMLQZGLGJVDX-CHWSQXEVSA-N |
| XLogP | 1.49 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|