C19H36N2O8S — CID 87851758
tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 87851758) has the molecular formula C19H36N2O8S and a molecular weight of 452.57 g/mol. Its IUPAC name is tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87851758 |
| Molecular Formula | C19H36N2O8S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C1.CC(C)(C)OC(=O)N1CCC(OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C10H19NO5S.C9H17NO3/c1-10(2,3)15-9(12)11-6-5-8(7-11)16-17(4,13)14;1-9(2,3)13-8(12)10-5-4-7(11)6-10/h8H,5-7H2,1-4H3;7,11H,4-6H2,1-3H3 |
| InChIKey | WGUNIMNJDUSMQG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|