C12H23N3O5S — CID 167488859
tert-butyl 3-(1-sulfamoylazetidin-3-yl)oxypyrrolidine-1-carboxylate (PubChem CID 167488859) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is tert-butyl 3-(1-sulfamoylazetidin-3-yl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1-sulfamoylazetidin-3-yl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167488859 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | tert-butyl 3-(1-sulfamoylazetidin-3-yl)oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OC2CN(S(N)(=O)=O)C2)C1 |
| InChI | InChI=1S/C12H23N3O5S/c1-12(2,3)20-11(16)14-5-4-9(6-14)19-10-7-15(8-10)21(13,17)18/h9-10H,4-8H2,1-3H3,(H2,13,17,18) |
| InChIKey | ZRPNDZVLERCIKI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |