C22H32N2O7S — CID 123344046
tert-butyl 4-(3-methylsulfonyloxy-2-oxo-4-phenylmethoxypyrrolidin-1-yl)piperidine-1-carboxylate (PubChem CID 123344046) has the molecular formula C22H32N2O7S and a molecular weight of 468.57 g/mol. Its IUPAC name is tert-butyl 4-(3-methylsulfonyloxy-2-oxo-4-phenylmethoxypyrrolidin-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-methylsulfonyloxy-2-oxo-4-phenylmethoxypyrrolidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123344046 |
| Molecular Formula | C22H32N2O7S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | tert-butyl 4-(3-methylsulfonyloxy-2-oxo-4-phenylmethoxypyrrolidin-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CC(OCc3ccccc3)C(OS(C)(=O)=O)C2=O)CC1 |
| InChI | InChI=1S/C22H32N2O7S/c1-22(2,3)30-21(26)23-12-10-17(11-13-23)24-14-18(19(20(24)25)31-32(4,27)28)29-15-16-8-6-5-7-9-16/h5-9,17-19H,10-15H2,1-4H3 |
| InChIKey | ZGKVKFKHVXAIBV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|