C22H44N2O6Si — CID 173291267
tert-butyl (2S,4R)-2-[2-(butoxycarbonylamino)-1-hydroxyethyl]-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 173291267) has the molecular formula C22H44N2O6Si and a molecular weight of 460.69 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[2-(butoxycarbonylamino)-1-hydroxyethyl]-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[2-(butoxycarbonylamino)-1-hydroxyethyl]-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173291267 |
| Molecular Formula | C22H44N2O6Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | tert-butyl (2S,4R)-2-[2-(butoxycarbonylamino)-1-hydroxyethyl]-4-tert-butyl-2-dimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)NCC(O)[C@@]1(O[SiH](C)C)C[C@H](C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H44N2O6Si/c1-10-11-12-28-18(26)23-14-17(25)22(30-31(8)9)13-16(20(2,3)4)15-24(22)19(27)29-21(5,6)7/h16-17,25,31H,10-15H2,1-9H3,(H,23,26)/t16-,17?,22-/m0/s1 |
| InChIKey | MTMFHWNMTPHLHV-ZHDKVYCTSA-N |
| XLogP | 3.87 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|