C17H27N3O6 — CID 126573329
4-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl] 1-O-prop-2-enyl piperazine-1,4-dicarboxylate (PubChem CID 126573329) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl] 1-O-prop-2-enyl piperazine-1,4-dicarboxylate.
| Compound Name | 4-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl] 1-O-prop-2-enyl piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 126573329 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl] 1-O-prop-2-enyl piperazine-1,4-dicarboxylate |
| SMILES | C=CCOC(=O)N1CCN(C(=O)OC2CN(C(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C17H27N3O6/c1-5-10-24-14(21)18-6-8-19(9-7-18)15(22)25-13-11-20(12-13)16(23)26-17(2,3)4/h5,13H,1,6-12H2,2-4H3 |
| InChIKey | VZLSRYDVLDSNMY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|