C28H37NO5 — CID 178133707
dibenzyl (3S)-5-tert-butyl-3-(2-methoxyethyl)piperidine-1,3-dicarboxylate (PubChem CID 178133707) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is dibenzyl (3S)-5-tert-butyl-3-(2-methoxyethyl)piperidine-1,3-dicarboxylate.
| Compound Name | dibenzyl (3S)-5-tert-butyl-3-(2-methoxyethyl)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 178133707 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | dibenzyl (3S)-5-tert-butyl-3-(2-methoxyethyl)piperidine-1,3-dicarboxylate |
| SMILES | COCC[C@@]1(C(=O)OCc2ccccc2)CC(C(C)(C)C)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C28H37NO5/c1-27(2,3)24-17-28(15-16-32-4,25(30)33-19-22-11-7-5-8-12-22)21-29(18-24)26(31)34-20-23-13-9-6-10-14-23/h5-14,24H,15-21H2,1-4H3/t24?,28-/m1/s1 |
| InChIKey | ROTRCLKYKLKWGA-ITCMONMYSA-N |
| XLogP | 5.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |