C14H17F2NO3 — CID 177327029
benzyl 3,3-difluoro-5-methoxypiperidine-1-carboxylate (PubChem CID 177327029) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is benzyl 3,3-difluoro-5-methoxypiperidine-1-carboxylate.
| Compound Name | benzyl 3,3-difluoro-5-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177327029 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | benzyl 3,3-difluoro-5-methoxypiperidine-1-carboxylate |
| SMILES | COC1CN(C(=O)OCc2ccccc2)CC(F)(F)C1 |
| InChI | InChI=1S/C14H17F2NO3/c1-19-12-7-14(15,16)10-17(8-12)13(18)20-9-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3 |
| InChIKey | ACJWNACOYOIDBL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |