C27H32N2O7S — CID 70276005
2-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] (2S,4S)-2-ethenyl-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 70276005) has the molecular formula C27H32N2O7S and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] (2S,4S)-2-ethenyl-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] (2S,4S)-2-ethenyl-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70276005 |
| Molecular Formula | C27H32N2O7S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-O-tert-butyl 1-O-[(4-nitrophenyl)methyl] (2S,4S)-2-ethenyl-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C[C@]1(C(=O)OC(C)(C)C)C[C@H](SCc2ccc(OC)cc2)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H32N2O7S/c1-6-27(24(30)36-26(2,3)4)15-23(37-18-20-9-13-22(34-5)14-10-20)16-28(27)25(31)35-17-19-7-11-21(12-8-19)29(32)33/h6-14,23H,1,15-18H2,2-5H3/t23-,27+/m0/s1 |
| InChIKey | AKTOYTZESRPSJV-WNCULLNHSA-N |
| XLogP | 5.51 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|