C29H33N5O6S — CID 67585081
(4-nitrophenyl)methyl (2S,4S)-2-(2-imidazol-1-ylpiperidine-1-carbonyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 67585081) has the molecular formula C29H33N5O6S and a molecular weight of 579.68 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-(2-imidazol-1-ylpiperidine-1-carbonyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-(2-imidazol-1-ylpiperidine-1-carbonyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67585081 |
| Molecular Formula | C29H33N5O6S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-(2-imidazol-1-ylpiperidine-1-carbonyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(CS[C@H]2C[C@@H](C(=O)N3CCCCC3n3ccnc3)N(C(=O)OCc3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C29H33N5O6S/c1-39-24-11-7-22(8-12-24)19-41-25-16-26(28(35)32-14-3-2-4-27(32)31-15-13-30-20-31)33(17-25)29(36)40-18-21-5-9-23(10-6-21)34(37)38/h5-13,15,20,25-27H,2-4,14,16-19H2,1H3/t25-,26-,27?/m0/s1 |
| InChIKey | RDXHDTJCFOPNJD-TXIPYEPDSA-N |
| XLogP | 5.02 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|