C35H27N3O14 — CID 89358853
tris[(4-nitrophenyl)methyl] 7-(2-methoxy-2-oxoethyl)cubane-1,2,4-tricarboxylate (PubChem CID 89358853) has the molecular formula C35H27N3O14 and a molecular weight of 713.61 g/mol. Its IUPAC name is tris[(4-nitrophenyl)methyl] 7-(2-methoxy-2-oxoethyl)cubane-1,2,4-tricarboxylate.
| Compound Name | tris[(4-nitrophenyl)methyl] 7-(2-methoxy-2-oxoethyl)cubane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 89358853 |
| Molecular Formula | C35H27N3O14 |
| Molecular Weight | 713.61 g/mol |
| Exact Mass | 713.15 |
| IUPAC Name | tris[(4-nitrophenyl)methyl] 7-(2-methoxy-2-oxoethyl)cubane-1,2,4-tricarboxylate |
| SMILES | COC(=O)CC12C3C4C1(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1C2C3(C(=O)OCc2ccc([N+](=O)[O-])cc2)C41C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H27N3O14/c1-49-24(39)14-32-25-27-33(32,29(40)50-15-18-2-8-21(9-3-18)36(43)44)28-26(32)34(25,30(41)51-16-19-4-10-22(11-5-19)37(45)46)35(27,28)31(42)52-17-20-6-12-23(13-7-20)38(47)48/h2-13,25-28H,14-17H2,1H3 |
| InChIKey | HOPIIHHNJORQLH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 234.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|