C23H28FN8O8P — CID 129033302
(2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(1-methyl-5-nitropyrrol-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol (PubChem CID 129033302) has the molecular formula C23H28FN8O8P and a molecular weight of 594.50 g/mol. Its IUPAC name is (2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(1-methyl-5-nitropyrrol-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol.
| Compound Name | (2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(1-methyl-5-nitropyrrol-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol |
|---|---|
| PubChem CID | 129033302 |
| Molecular Formula | C23H28FN8O8P |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | (2R,3R)-3-[(6-amino-2-fluoropurin-9-yl)methoxy]-4-[(benzylamino)-[(1-methyl-5-nitropyrrol-2-yl)methoxy]phosphoryl]oxybutane-1,2-diol |
| SMILES | Cn1c(COP(=O)(NCc2ccccc2)OC[C@@H](OCn2cnc3c(N)nc(F)nc32)[C@H](O)CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28FN8O8P/c1-30-16(7-8-19(30)32(35)36)11-39-41(37,27-9-15-5-3-2-4-6-15)40-12-18(17(34)10-33)38-14-31-13-26-20-21(25)28-23(24)29-22(20)31/h2-8,13,17-18,33-34H,9-12,14H2,1H3,(H,27,37)(H2,25,28,29)/t17-,18-,41?/m1/s1 |
| InChIKey | PIRINVNJLRWDSW-SABJIIJHSA-N |
| XLogP | 1.62 |
| TPSA | 214.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|