C9H14N2O6 — CID 11021171
(2R,3S)-3-[(2-nitropyrrol-1-yl)methoxy]butane-1,2,4-triol (PubChem CID 11021171) has the molecular formula C9H14N2O6 and a molecular weight of 246.22 g/mol. Its IUPAC name is (2R,3S)-3-[(2-nitropyrrol-1-yl)methoxy]butane-1,2,4-triol.
| Compound Name | (2R,3S)-3-[(2-nitropyrrol-1-yl)methoxy]butane-1,2,4-triol |
|---|---|
| PubChem CID | 11021171 |
| Molecular Formula | C9H14N2O6 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2R,3S)-3-[(2-nitropyrrol-1-yl)methoxy]butane-1,2,4-triol |
| SMILES | O=[N+]([O-])c1cccn1CO[C@@H](CO)[C@H](O)CO |
| InChI | InChI=1S/C9H14N2O6/c12-4-7(14)8(5-13)17-6-10-3-1-2-9(10)11(15)16/h1-3,7-8,12-14H,4-6H2/t7-,8+/m1/s1 |
| InChIKey | QEYWDAGKLANGOI-SFYZADRCSA-N |
| XLogP | -0.92 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|