C9H9F3N2O3 — CID 158724119
5-(18F)fluoro-5,5-difluoro-1-(2-nitropyrrol-1-yl)pentan-2-one (PubChem CID 158724119) has the molecular formula C9H9F3N2O3 and a molecular weight of 249.18 g/mol. Its IUPAC name is 5-(18F)fluoro-5,5-difluoro-1-(2-nitropyrrol-1-yl)pentan-2-one.
| Compound Name | 5-(18F)fluoro-5,5-difluoro-1-(2-nitropyrrol-1-yl)pentan-2-one |
|---|---|
| PubChem CID | 158724119 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 5-(18F)fluoro-5,5-difluoro-1-(2-nitropyrrol-1-yl)pentan-2-one |
| SMILES | O=C(CCC(F)(F)[18F])Cn1cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9F3N2O3/c10-9(11,12)4-3-7(15)6-13-5-1-2-8(13)14(16)17/h1-2,5H,3-4,6H2/i10-1 |
| InChIKey | KUBJQVQELCPVJM-LMANFOLPSA-N |
| XLogP | 2.31 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|