C9H9F4N3O3 — CID 159884942
5,5,5-trifluoro-1-[2-((18F)fluoromethyl)-4-nitroimidazol-1-yl]pentan-2-one (PubChem CID 159884942) has the molecular formula C9H9F4N3O3 and a molecular weight of 282.18 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[2-((18F)fluoromethyl)-4-nitroimidazol-1-yl]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-[2-((18F)fluoromethyl)-4-nitroimidazol-1-yl]pentan-2-one |
|---|---|
| PubChem CID | 159884942 |
| Molecular Formula | C9H9F4N3O3 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5,5,5-trifluoro-1-[2-((18F)fluoromethyl)-4-nitroimidazol-1-yl]pentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cn1cc([N+](=O)[O-])nc1C[18F] |
| InChI | InChI=1S/C9H9F4N3O3/c10-3-7-14-8(16(18)19)5-15(7)4-6(17)1-2-9(11,12)13/h5H,1-4H2/i10-1 |
| InChIKey | RKKLQHPCBIBWNP-LMANFOLPSA-N |
| XLogP | 2.17 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|