C12H12F3N7O3 — CID 124854955
2-(2-methyl-4-nitroimidazol-1-yl)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide (PubChem CID 124854955) has the molecular formula C12H12F3N7O3 and a molecular weight of 359.27 g/mol. Its IUPAC name is 2-(2-methyl-4-nitroimidazol-1-yl)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(2-methyl-4-nitroimidazol-1-yl)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124854955 |
| Molecular Formula | C12H12F3N7O3 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-(2-methyl-4-nitroimidazol-1-yl)-N-[(Z)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1nc([N+](=O)[O-])cn1CC(=O)N/N=C\c1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H12F3N7O3/c1-8-17-10(22(24)25)5-20(8)6-11(23)18-16-4-9-2-3-21(19-9)7-12(13,14)15/h2-5H,6-7H2,1H3,(H,18,23)/b16-4- |
| InChIKey | YEQMIXKFXLKRLQ-XRVIQIRUSA-N |
| XLogP | 1.01 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|