C12H13F3N6O — CID 171131122
2-(5-methylpyrazol-1-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide (PubChem CID 171131122) has the molecular formula C12H13F3N6O and a molecular weight of 314.27 g/mol. Its IUPAC name is 2-(5-methylpyrazol-1-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(5-methylpyrazol-1-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 171131122 |
| Molecular Formula | C12H13F3N6O |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-(5-methylpyrazol-1-yl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1ccnn1CC(=O)NN=Cc1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H13F3N6O/c1-9-2-4-17-21(9)7-11(22)18-16-6-10-3-5-20(19-10)8-12(13,14)15/h2-6H,7-8H2,1H3,(H,18,22) |
| InChIKey | QEUAEZUPCCKRDE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|