C14H15F5N6O — CID 124877745
(2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]propanamide (PubChem CID 124877745) has the molecular formula C14H15F5N6O and a molecular weight of 378.31 g/mol. Its IUPAC name is (2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]propanamide.
| Compound Name | (2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 124877745 |
| Molecular Formula | C14H15F5N6O |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2R)-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]propanamide |
| SMILES | Cc1cc(C(F)F)nn1[C@H](C)C(=O)N/N=C/c1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C14H15F5N6O/c1-8-5-11(12(15)16)23-25(8)9(2)13(26)21-20-6-10-3-4-24(22-10)7-14(17,18)19/h3-6,9,12H,7H2,1-2H3,(H,21,26)/b20-6+/t9-/m1/s1 |
| InChIKey | UTAKZABWYGVPKQ-JXVSOWSCSA-N |
| XLogP | 2.60 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|